About 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one
1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one (PubChem CID 10774464) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one.
Analyze 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one?
The IUPAC name of 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one (CID 10774464) is 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one.
What is the SMILES notation for 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one?
The canonical SMILES for 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one is COCC(=O)CCCC1(C)OCCO1.
What is the InChIKey of 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one?
The InChIKey is XOEKATJEKGCIEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-10(13-6-7-14-10)5-3-4-9(11)8-12-2/h3-8H2,1-2H3.
What are the key properties of 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one?
1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one has a molecular weight of 202.25 g/mol, XLogP of 1.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-5-(2-methyl-1,3-dioxolan-2-yl)pentan-2-one is sourced from PubChem (CID 10774464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).