C14H21NO4 — CID 107745034
1-amino-2-cyclopropyl-3-[4-(hydroxymethyl)-2-methoxyphenoxy]propan-2-ol (PubChem CID 107745034) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-amino-2-cyclopropyl-3-[4-(hydroxymethyl)-2-methoxyphenoxy]propan-2-ol.
| Compound Name | 1-amino-2-cyclopropyl-3-[4-(hydroxymethyl)-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 107745034 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-amino-2-cyclopropyl-3-[4-(hydroxymethyl)-2-methoxyphenoxy]propan-2-ol |
| SMILES | COc1cc(CO)ccc1OCC(O)(CN)C1CC1 |
| InChI | InChI=1S/C14H21NO4/c1-18-13-6-10(7-16)2-5-12(13)19-9-14(17,8-15)11-3-4-11/h2,5-6,11,16-17H,3-4,7-9,15H2,1H3 |
| InChIKey | MASCBPXTTJIFOS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |