C15H18O3S — CID 107746310
3-(2-methylbutylsulfanylmethyl)-1-benzofuran-2-carboxylic acid (PubChem CID 107746310) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is 3-(2-methylbutylsulfanylmethyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 3-(2-methylbutylsulfanylmethyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 107746310 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 3-(2-methylbutylsulfanylmethyl)-1-benzofuran-2-carboxylic acid |
| SMILES | CCC(C)CSCc1c(C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C15H18O3S/c1-3-10(2)8-19-9-12-11-6-4-5-7-13(11)18-14(12)15(16)17/h4-7,10H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | NXOSDLXIWQUIMD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |