C13H17BrO4S — CID 107746637
3-bromo-4-(3-methylbutan-2-ylsulfonylmethyl)benzoic acid (PubChem CID 107746637) has the molecular formula C13H17BrO4S and a molecular weight of 349.25 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutan-2-ylsulfonylmethyl)benzoic acid.
| Compound Name | 3-bromo-4-(3-methylbutan-2-ylsulfonylmethyl)benzoic acid |
|---|---|
| PubChem CID | 107746637 |
| Molecular Formula | C13H17BrO4S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 3-bromo-4-(3-methylbutan-2-ylsulfonylmethyl)benzoic acid |
| SMILES | CC(C)C(C)S(=O)(=O)Cc1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C13H17BrO4S/c1-8(2)9(3)19(17,18)7-11-5-4-10(13(15)16)6-12(11)14/h4-6,8-9H,7H2,1-3H3,(H,15,16) |
| InChIKey | SDZDYQLXGMTXDD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |