C14H21ClN2OS — CID 107748453
N-(3-amino-4-chlorophenyl)-3-pentylsulfanylpropanamide (PubChem CID 107748453) has the molecular formula C14H21ClN2OS and a molecular weight of 300.85 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3-pentylsulfanylpropanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3-pentylsulfanylpropanamide |
|---|---|
| PubChem CID | 107748453 |
| Molecular Formula | C14H21ClN2OS |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3-pentylsulfanylpropanamide |
| SMILES | CCCCCSCCC(=O)Nc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C14H21ClN2OS/c1-2-3-4-8-19-9-7-14(18)17-11-5-6-12(15)13(16)10-11/h5-6,10H,2-4,7-9,16H2,1H3,(H,17,18) |
| InChIKey | MLQVLZUJPAYZGT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|