C12H17ClN2O3S2 — CID 63659554
N-(3-amino-4-chlorophenyl)-3-(2-methylsulfonylethylsulfanyl)propanamide (PubChem CID 63659554) has the molecular formula C12H17ClN2O3S2 and a molecular weight of 336.87 g/mol. Its IUPAC name is N-(3-amino-4-chlorophenyl)-3-(2-methylsulfonylethylsulfanyl)propanamide.
| Compound Name | N-(3-amino-4-chlorophenyl)-3-(2-methylsulfonylethylsulfanyl)propanamide |
|---|---|
| PubChem CID | 63659554 |
| Molecular Formula | C12H17ClN2O3S2 |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(3-amino-4-chlorophenyl)-3-(2-methylsulfonylethylsulfanyl)propanamide |
| SMILES | CS(=O)(=O)CCSCCC(=O)Nc1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C12H17ClN2O3S2/c1-20(17,18)7-6-19-5-4-12(16)15-9-2-3-10(13)11(14)8-9/h2-3,8H,4-7,14H2,1H3,(H,15,16) |
| InChIKey | CEDGAFSISRVRKR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|