C16H27NS — CID 107748828
1-(2-methylbutylsulfanyl)-1-(4-methylphenyl)butan-2-amine (PubChem CID 107748828) has the molecular formula C16H27NS and a molecular weight of 265.47 g/mol. Its IUPAC name is 1-(2-methylbutylsulfanyl)-1-(4-methylphenyl)butan-2-amine.
| Compound Name | 1-(2-methylbutylsulfanyl)-1-(4-methylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 107748828 |
| Molecular Formula | C16H27NS |
| Molecular Weight | 265.47 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1-(2-methylbutylsulfanyl)-1-(4-methylphenyl)butan-2-amine |
| SMILES | CCC(C)CSC(c1ccc(C)cc1)C(N)CC |
| InChI | InChI=1S/C16H27NS/c1-5-12(3)11-18-16(15(17)6-2)14-9-7-13(4)8-10-14/h7-10,12,15-16H,5-6,11,17H2,1-4H3 |
| InChIKey | UQWZZOZGDXVLLZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |