C13H18FNOS — CID 107750531
(1S)-1-[2-fluoro-6-(2-methyloxolan-3-yl)sulfanylphenyl]ethanamine (PubChem CID 107750531) has the molecular formula C13H18FNOS and a molecular weight of 255.36 g/mol. Its IUPAC name is (1S)-1-[2-fluoro-6-(2-methyloxolan-3-yl)sulfanylphenyl]ethanamine.
| Compound Name | (1S)-1-[2-fluoro-6-(2-methyloxolan-3-yl)sulfanylphenyl]ethanamine |
|---|---|
| PubChem CID | 107750531 |
| Molecular Formula | C13H18FNOS |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (1S)-1-[2-fluoro-6-(2-methyloxolan-3-yl)sulfanylphenyl]ethanamine |
| SMILES | CC1OCCC1Sc1cccc(F)c1[C@H](C)N |
| InChI | InChI=1S/C13H18FNOS/c1-8(15)13-10(14)4-3-5-12(13)17-11-6-7-16-9(11)2/h3-5,8-9,11H,6-7,15H2,1-2H3/t8-,9?,11?/m0/s1 |
| InChIKey | ZQCNBPORCAZPAY-SILCLGDVSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |