C14H20ClNOS — CID 107762315
1-[4-chloro-2-(2-methyloxolan-3-yl)sulfanylphenyl]propan-2-amine (PubChem CID 107762315) has the molecular formula C14H20ClNOS and a molecular weight of 285.84 g/mol. Its IUPAC name is 1-[4-chloro-2-(2-methyloxolan-3-yl)sulfanylphenyl]propan-2-amine.
| Compound Name | 1-[4-chloro-2-(2-methyloxolan-3-yl)sulfanylphenyl]propan-2-amine |
|---|---|
| PubChem CID | 107762315 |
| Molecular Formula | C14H20ClNOS |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-[4-chloro-2-(2-methyloxolan-3-yl)sulfanylphenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(Cl)cc1SC1CCOC1C |
| InChI | InChI=1S/C14H20ClNOS/c1-9(16)7-11-3-4-12(15)8-14(11)18-13-5-6-17-10(13)2/h3-4,8-10,13H,5-7,16H2,1-2H3 |
| InChIKey | VPVDCEWJSQJHRS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |