C11H15ClN4S — CID 107751048
5-chloro-6-methyl-7-pentylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 107751048) has the molecular formula C11H15ClN4S and a molecular weight of 270.79 g/mol. Its IUPAC name is 5-chloro-6-methyl-7-pentylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5-chloro-6-methyl-7-pentylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 107751048 |
| Molecular Formula | C11H15ClN4S |
| Molecular Weight | 270.79 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 5-chloro-6-methyl-7-pentylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCCCCSc1c(C)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C11H15ClN4S/c1-3-4-5-6-17-10-8(2)9(12)15-11-13-7-14-16(10)11/h7H,3-6H2,1-2H3 |
| InChIKey | DEWOULKNSWXSJJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.79 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|