C15H23FN2O2S — CID 107753823
N-(2-amino-4-fluorophenyl)-4-(2-methylbutylsulfinyl)butanamide (PubChem CID 107753823) has the molecular formula C15H23FN2O2S and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-(2-methylbutylsulfinyl)butanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-(2-methylbutylsulfinyl)butanamide |
|---|---|
| PubChem CID | 107753823 |
| Molecular Formula | C15H23FN2O2S |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-(2-methylbutylsulfinyl)butanamide |
| SMILES | CCC(C)CS(=O)CCCC(=O)Nc1ccc(F)cc1N |
| InChI | InChI=1S/C15H23FN2O2S/c1-3-11(2)10-21(20)8-4-5-15(19)18-14-7-6-12(16)9-13(14)17/h6-7,9,11H,3-5,8,10,17H2,1-2H3,(H,18,19) |
| InChIKey | LNLSHMYFZUDJIW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|