C14H27NO3S — CID 107755163
methyl 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylpentanoate (PubChem CID 107755163) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is methyl 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylpentanoate.
| Compound Name | methyl 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylpentanoate |
|---|---|
| PubChem CID | 107755163 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | methyl 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylpentanoate |
| SMILES | CCNC(C)(CC(C)SC1CCOC1C)C(=O)OC |
| InChI | InChI=1S/C14H27NO3S/c1-6-15-14(4,13(16)17-5)9-10(2)19-12-7-8-18-11(12)3/h10-12,15H,6-9H2,1-5H3 |
| InChIKey | LBLBOLIFIARINO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |