C12H24N2O2S — CID 107755324
2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylbutanamide (PubChem CID 107755324) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylbutanamide.
| Compound Name | 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 107755324 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(ethylamino)-2-methyl-4-(2-methyloxolan-3-yl)sulfanylbutanamide |
| SMILES | CCNC(C)(CCSC1CCOC1C)C(N)=O |
| InChI | InChI=1S/C12H24N2O2S/c1-4-14-12(3,11(13)15)6-8-17-10-5-7-16-9(10)2/h9-10,14H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | MDQMZASQKCISAQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |