C11H22N2OS — CID 107750203
2,2-dimethyl-4-(2-methyloxolan-3-yl)sulfanylbutanimidamide (PubChem CID 107750203) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-methyloxolan-3-yl)sulfanylbutanimidamide.
| Compound Name | 2,2-dimethyl-4-(2-methyloxolan-3-yl)sulfanylbutanimidamide |
|---|---|
| PubChem CID | 107750203 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,2-dimethyl-4-(2-methyloxolan-3-yl)sulfanylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCSC1CCOC1C |
| InChI | InChI=1S/C11H22N2OS/c1-8-9(4-6-14-8)15-7-5-11(2,3)10(12)13/h8-9H,4-7H2,1-3H3,(H3,12,13) |
| InChIKey | QVMDTLWRITXBLM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|