C12H22N2O2S — CID 107755232
2-(cyclopropylamino)-2-methyl-3-(2-methyloxolan-3-yl)sulfanylpropanamide (PubChem CID 107755232) has the molecular formula C12H22N2O2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 2-(cyclopropylamino)-2-methyl-3-(2-methyloxolan-3-yl)sulfanylpropanamide.
| Compound Name | 2-(cyclopropylamino)-2-methyl-3-(2-methyloxolan-3-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 107755232 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-(cyclopropylamino)-2-methyl-3-(2-methyloxolan-3-yl)sulfanylpropanamide |
| SMILES | CC1OCCC1SCC(C)(NC1CC1)C(N)=O |
| InChI | InChI=1S/C12H22N2O2S/c1-8-10(5-6-16-8)17-7-12(2,11(13)15)14-9-3-4-9/h8-10,14H,3-7H2,1-2H3,(H2,13,15) |
| InChIKey | WUCPLASFSOBJMO-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |