C14H28N2 — CID 10775540
1-N,3-N-dibutyl-2-methylidenepent-4-ene-1,3-diamine (PubChem CID 10775540) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-N,3-N-dibutyl-2-methylidenepent-4-ene-1,3-diamine.
| Compound Name | 1-N,3-N-dibutyl-2-methylidenepent-4-ene-1,3-diamine |
|---|---|
| PubChem CID | 10775540 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-N,3-N-dibutyl-2-methylidenepent-4-ene-1,3-diamine |
| SMILES | C=CC(NCCCC)C(=C)CNCCCC |
| InChI | InChI=1S/C14H28N2/c1-5-8-10-15-12-13(4)14(7-3)16-11-9-6-2/h7,14-16H,3-6,8-12H2,1-2H3 |
| InChIKey | UBAMFWRKRRBXKP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|