C14H29NO2S — CID 107756102
2-ethyl-2-(ethylamino)-5-(2-methylbutylsulfanyl)pentanoic acid (PubChem CID 107756102) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is 2-ethyl-2-(ethylamino)-5-(2-methylbutylsulfanyl)pentanoic acid.
| Compound Name | 2-ethyl-2-(ethylamino)-5-(2-methylbutylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 107756102 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-ethyl-2-(ethylamino)-5-(2-methylbutylsulfanyl)pentanoic acid |
| SMILES | CCNC(CC)(CCCSCC(C)CC)C(=O)O |
| InChI | InChI=1S/C14H29NO2S/c1-5-12(4)11-18-10-8-9-14(6-2,13(16)17)15-7-3/h12,15H,5-11H2,1-4H3,(H,16,17) |
| InChIKey | OSVTZQJYDNDVKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|