C14H24N2S — CID 107756485
5-(pentylsulfanylmethyl)-N-propylpyridin-2-amine (PubChem CID 107756485) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 5-(pentylsulfanylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 5-(pentylsulfanylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 107756485 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 5-(pentylsulfanylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCCCSCc1ccc(NCCC)nc1 |
| InChI | InChI=1S/C14H24N2S/c1-3-5-6-10-17-12-13-7-8-14(16-11-13)15-9-4-2/h7-8,11H,3-6,9-10,12H2,1-2H3,(H,15,16) |
| InChIKey | PXHOQFMNIJSBPV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|