C15H17FN2S — CID 55044942
5-[(2-fluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine (PubChem CID 55044942) has the molecular formula C15H17FN2S and a molecular weight of 276.38 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine.
| Compound Name | 5-[(2-fluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 55044942 |
| Molecular Formula | C15H17FN2S |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 5-[(2-fluorophenyl)sulfanylmethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(CSc2ccccc2F)cn1 |
| InChI | InChI=1S/C15H17FN2S/c1-2-9-17-15-8-7-12(10-18-15)11-19-14-6-4-3-5-13(14)16/h3-8,10H,2,9,11H2,1H3,(H,17,18) |
| InChIKey | QFXUIATUSWLEEI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |