C15H23NO4S — CID 107758131
1-(2-methoxyphenyl)-N-methyl-2-(2-methyloxolan-3-yl)sulfonylethanamine (PubChem CID 107758131) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-N-methyl-2-(2-methyloxolan-3-yl)sulfonylethanamine.
| Compound Name | 1-(2-methoxyphenyl)-N-methyl-2-(2-methyloxolan-3-yl)sulfonylethanamine |
|---|---|
| PubChem CID | 107758131 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 1-(2-methoxyphenyl)-N-methyl-2-(2-methyloxolan-3-yl)sulfonylethanamine |
| SMILES | CNC(CS(=O)(=O)C1CCOC1C)c1ccccc1OC |
| InChI | InChI=1S/C15H23NO4S/c1-11-15(8-9-20-11)21(17,18)10-13(16-2)12-6-4-5-7-14(12)19-3/h4-7,11,13,15-16H,8-10H2,1-3H3 |
| InChIKey | DMOMPLLTVKBRGG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |