C9H18O5S — CID 107764097
3-(2,2-dimethoxyethylsulfonyl)-2-methyloxolane (PubChem CID 107764097) has the molecular formula C9H18O5S and a molecular weight of 238.30 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethylsulfonyl)-2-methyloxolane.
| Compound Name | 3-(2,2-dimethoxyethylsulfonyl)-2-methyloxolane |
|---|---|
| PubChem CID | 107764097 |
| Molecular Formula | C9H18O5S |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-(2,2-dimethoxyethylsulfonyl)-2-methyloxolane |
| SMILES | COC(CS(=O)(=O)C1CCOC1C)OC |
| InChI | InChI=1S/C9H18O5S/c1-7-8(4-5-14-7)15(10,11)6-9(12-2)13-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | HZDWAOMUNXLDRJ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|