(2R,3S)-2-methyloxolane-3-sulfonyl chloride

C5H9ClO3S — CID 98113530

IUPAC(2R,3S)-2-methyloxolane-3-sulfonyl chloride
SMILESC[C@H]1OCC[C@@H]1S(=O)(=O)Cl
InChIInChI=1S/C5H9ClO3S/c1-4-5(2-3-9-4)10(6,7)8/h4-5H,2-3H2,1H3/t4-,5+/m1/s1
InChIKeyQVLPVLSXOXONOK-UHNVWZDZSA-N
MW184.64 g/mol
LogP0.73
Rot. Bonds1

About (2R,3S)-2-methyloxolane-3-sulfonyl chloride

(2R,3S)-2-methyloxolane-3-sulfonyl chloride (PubChem CID 98113530) has the molecular formula C5H9ClO3S and a molecular weight of 184.64 g/mol. Its IUPAC name is (2R,3S)-2-methyloxolane-3-sulfonyl chloride.

Molecular Properties

Compound Name(2R,3S)-2-methyloxolane-3-sulfonyl chloride
PubChem CID98113530
Molecular FormulaC5H9ClO3S
Molecular Weight184.64 g/mol
Exact Mass184.00
IUPAC Name(2R,3S)-2-methyloxolane-3-sulfonyl chloride
SMILESC[C@H]1OCC[C@@H]1S(=O)(=O)Cl
InChIInChI=1S/C5H9ClO3S/c1-4-5(2-3-9-4)10(6,7)8/h4-5H,2-3H2,1H3/t4-,5+/m1/s1
InChIKeyQVLPVLSXOXONOK-UHNVWZDZSA-N
XLogP0.73
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.64
LogP ≤ 50.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (2R,3S)-2-methyloxolane-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S)-2-methyloxolane-3-sulfonyl chloride?
The IUPAC name of (2R,3S)-2-methyloxolane-3-sulfonyl chloride (CID 98113530) is (2R,3S)-2-methyloxolane-3-sulfonyl chloride.
What is the SMILES notation for (2R,3S)-2-methyloxolane-3-sulfonyl chloride?
The canonical SMILES for (2R,3S)-2-methyloxolane-3-sulfonyl chloride is C[C@H]1OCC[C@@H]1S(=O)(=O)Cl.
What is the InChIKey of (2R,3S)-2-methyloxolane-3-sulfonyl chloride?
The InChIKey is QVLPVLSXOXONOK-UHNVWZDZSA-N. The full InChI is InChI=1S/C5H9ClO3S/c1-4-5(2-3-9-4)10(6,7)8/h4-5H,2-3H2,1H3/t4-,5+/m1/s1.
What are the key properties of (2R,3S)-2-methyloxolane-3-sulfonyl chloride?
(2R,3S)-2-methyloxolane-3-sulfonyl chloride has a molecular weight of 184.64 g/mol, XLogP of 0.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2-methyloxolane-3-sulfonyl chloride is sourced from PubChem (CID 98113530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).