C5H9ClO3S — CID 98113530
(2R,3S)-2-methyloxolane-3-sulfonyl chloride (PubChem CID 98113530) has the molecular formula C5H9ClO3S and a molecular weight of 184.64 g/mol. Its IUPAC name is (2R,3S)-2-methyloxolane-3-sulfonyl chloride.
| Compound Name | (2R,3S)-2-methyloxolane-3-sulfonyl chloride |
|---|---|
| PubChem CID | 98113530 |
| Molecular Formula | C5H9ClO3S |
| Molecular Weight | 184.64 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | (2R,3S)-2-methyloxolane-3-sulfonyl chloride |
| SMILES | C[C@H]1OCC[C@@H]1S(=O)(=O)Cl |
| InChI | InChI=1S/C5H9ClO3S/c1-4-5(2-3-9-4)10(6,7)8/h4-5H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | QVLPVLSXOXONOK-UHNVWZDZSA-N |
| XLogP | 0.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.64 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |