C6H11ClO3S — CID 98084898
(3S,4S)-3-methyloxane-4-sulfonyl chloride (PubChem CID 98084898) has the molecular formula C6H11ClO3S and a molecular weight of 198.67 g/mol. Its IUPAC name is (3S,4S)-3-methyloxane-4-sulfonyl chloride.
| Compound Name | (3S,4S)-3-methyloxane-4-sulfonyl chloride |
|---|---|
| PubChem CID | 98084898 |
| Molecular Formula | C6H11ClO3S |
| Molecular Weight | 198.67 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | (3S,4S)-3-methyloxane-4-sulfonyl chloride |
| SMILES | C[C@H]1COCC[C@@H]1S(=O)(=O)Cl |
| InChI | InChI=1S/C6H11ClO3S/c1-5-4-10-3-2-6(5)11(7,8)9/h5-6H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | BOOLPBBZCGYWEQ-WDSKDSINSA-N |
| XLogP | 0.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.67 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |