C6H13NO3S — CID 97177290
(3S,4R)-3-methyloxane-4-sulfonamide (PubChem CID 97177290) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is (3S,4R)-3-methyloxane-4-sulfonamide.
| Compound Name | (3S,4R)-3-methyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97177290 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (3S,4R)-3-methyloxane-4-sulfonamide |
| SMILES | C[C@H]1COCC[C@H]1S(N)(=O)=O |
| InChI | InChI=1S/C6H13NO3S/c1-5-4-10-3-2-6(5)11(7,8)9/h5-6H,2-4H2,1H3,(H2,7,8,9)/t5-,6+/m0/s1 |
| InChIKey | DDRAKEUZWHEQEX-NTSWFWBYSA-N |
| XLogP | -0.30 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |