C8H17NO3S — CID 97177278
(3S,4R)-N,N,3-trimethyloxane-4-sulfonamide (PubChem CID 97177278) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (3S,4R)-N,N,3-trimethyloxane-4-sulfonamide.
| Compound Name | (3S,4R)-N,N,3-trimethyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97177278 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3S,4R)-N,N,3-trimethyloxane-4-sulfonamide |
| SMILES | C[C@H]1COCC[C@H]1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C8H17NO3S/c1-7-6-12-5-4-8(7)13(10,11)9(2)3/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | UDHNFYVFJWJNIA-JGVFFNPUSA-N |
| XLogP | 0.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |