C9H17NO3S — CID 97177286
(3S,4R)-N-cyclopropyl-3-methyloxane-4-sulfonamide (PubChem CID 97177286) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is (3S,4R)-N-cyclopropyl-3-methyloxane-4-sulfonamide.
| Compound Name | (3S,4R)-N-cyclopropyl-3-methyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97177286 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3S,4R)-N-cyclopropyl-3-methyloxane-4-sulfonamide |
| SMILES | C[C@H]1COCC[C@H]1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C9H17NO3S/c1-7-6-13-5-4-9(7)14(11,12)10-8-2-3-8/h7-10H,2-6H2,1H3/t7-,9+/m0/s1 |
| InChIKey | WFGUJQHSNGSKKN-IONNQARKSA-N |
| XLogP | 0.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |