C10H16N2O2 — CID 130173978
N-(cyanomethyl)-N,3-dimethyloxane-4-carboxamide (PubChem CID 130173978) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is N-(cyanomethyl)-N,3-dimethyloxane-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N,3-dimethyloxane-4-carboxamide |
|---|---|
| PubChem CID | 130173978 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | N-(cyanomethyl)-N,3-dimethyloxane-4-carboxamide |
| SMILES | CC1COCCC1C(=O)N(C)CC#N |
| InChI | InChI=1S/C10H16N2O2/c1-8-7-14-6-3-9(8)10(13)12(2)5-4-11/h8-9H,3,5-7H2,1-2H3 |
| InChIKey | BKZMLTGGAMFUPV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|