C7H9N3O3 — CID 130751777
N-(cyanomethyl)-N-methyl-2-oxo-1,3-oxazolidine-4-carboxamide (PubChem CID 130751777) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is N-(cyanomethyl)-N-methyl-2-oxo-1,3-oxazolidine-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N-methyl-2-oxo-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 130751777 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | N-(cyanomethyl)-N-methyl-2-oxo-1,3-oxazolidine-4-carboxamide |
| SMILES | CN(CC#N)C(=O)C1COC(=O)N1 |
| InChI | InChI=1S/C7H9N3O3/c1-10(3-2-8)6(11)5-4-13-7(12)9-5/h5H,3-4H2,1H3,(H,9,12) |
| InChIKey | QTEXVECQCOUIPX-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|