C11H18N2O3 — CID 110649220
N-cycloheptyl-2-oxo-1,3-oxazolidine-4-carboxamide (PubChem CID 110649220) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-cycloheptyl-2-oxo-1,3-oxazolidine-4-carboxamide.
| Compound Name | N-cycloheptyl-2-oxo-1,3-oxazolidine-4-carboxamide |
|---|---|
| PubChem CID | 110649220 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-cycloheptyl-2-oxo-1,3-oxazolidine-4-carboxamide |
| SMILES | O=C1NC(C(=O)NC2CCCCCC2)CO1 |
| InChI | InChI=1S/C11H18N2O3/c14-10(9-7-16-11(15)13-9)12-8-5-3-1-2-4-6-8/h8-9H,1-7H2,(H,12,14)(H,13,15) |
| InChIKey | FNKRCRYPFAJMOY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |