C15H23NO3S — CID 107758959
1-(1,3-benzodioxol-5-yl)-N-methyl-2-pentylsulfinylethanamine (PubChem CID 107758959) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-methyl-2-pentylsulfinylethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-methyl-2-pentylsulfinylethanamine |
|---|---|
| PubChem CID | 107758959 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-methyl-2-pentylsulfinylethanamine |
| SMILES | CCCCCS(=O)CC(NC)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23NO3S/c1-3-4-5-8-20(17)10-13(16-2)12-6-7-14-15(9-12)19-11-18-14/h6-7,9,13,16H,3-5,8,10-11H2,1-2H3 |
| InChIKey | PXTMVJMQWCUIRY-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|