C13H27NOS — CID 107760118
2,2-dimethyl-6-(2-methylbutylsulfinyl)cyclohexan-1-amine (PubChem CID 107760118) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methylbutylsulfinyl)cyclohexan-1-amine.
| Compound Name | 2,2-dimethyl-6-(2-methylbutylsulfinyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 107760118 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2,2-dimethyl-6-(2-methylbutylsulfinyl)cyclohexan-1-amine |
| SMILES | CCC(C)CS(=O)C1CCCC(C)(C)C1N |
| InChI | InChI=1S/C13H27NOS/c1-5-10(2)9-16(15)11-7-6-8-13(3,4)12(11)14/h10-12H,5-9,14H2,1-4H3 |
| InChIKey | FULNXPWXBSOUJS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |