C14H25NO3S — CID 107760284
N-[[5-(3-methylbutylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine (PubChem CID 107760284) has the molecular formula C14H25NO3S and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[[5-(3-methylbutylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(3-methylbutylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107760284 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[[5-(3-methylbutylsulfonylmethyl)furan-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)CCS(=O)(=O)Cc1ccc(CNC(C)C)o1 |
| InChI | InChI=1S/C14H25NO3S/c1-11(2)7-8-19(16,17)10-14-6-5-13(18-14)9-15-12(3)4/h5-6,11-12,15H,7-10H2,1-4H3 |
| InChIKey | YZWKDISFGXEHBR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |