potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide

C6H13BF3KS — CID 107761098

IUPACpotassium trifluoro(2-methylbutylsulfanylmethyl)boranuide
SMILESCCC(C)CSC[B-](F)(F)F.[K+]
InChIInChI=1S/C6H13BF3S.K/c1-3-6(2)4-11-5-7(8,9)10;/h6H,3-5H2,1-2H3;/q-1;+1
InChIKeyCLXWDTKJVPCQOO-UHFFFAOYSA-N
MW224.14 g/mol
LogP0.16
Rot. Bonds5

About potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide

potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide (PubChem CID 107761098) has the molecular formula C6H13BF3KS and a molecular weight of 224.14 g/mol. Its IUPAC name is potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide.

Molecular Properties

Compound Namepotassium trifluoro(2-methylbutylsulfanylmethyl)boranuide
PubChem CID107761098
Molecular FormulaC6H13BF3KS
Molecular Weight224.14 g/mol
Exact Mass224.04
IUPAC Namepotassium trifluoro(2-methylbutylsulfanylmethyl)boranuide
SMILESCCC(C)CSC[B-](F)(F)F.[K+]
InChIInChI=1S/C6H13BF3S.K/c1-3-6(2)4-11-5-7(8,9)10;/h6H,3-5H2,1-2H3;/q-1;+1
InChIKeyCLXWDTKJVPCQOO-UHFFFAOYSA-N
XLogP0.16
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.14
LogP ≤ 50.16
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide?
The IUPAC name of potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide (CID 107761098) is potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide.
What is the SMILES notation for potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide?
The canonical SMILES for potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide is CCC(C)CSC[B-](F)(F)F.[K+].
What is the InChIKey of potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide?
The InChIKey is CLXWDTKJVPCQOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13BF3S.K/c1-3-6(2)4-11-5-7(8,9)10;/h6H,3-5H2,1-2H3;/q-1;+1.
What are the key properties of potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide?
potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide has a molecular weight of 224.14 g/mol, XLogP of 0.16, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro(2-methylbutylsulfanylmethyl)boranuide is sourced from PubChem (CID 107761098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).