C12H23N3S — CID 107761377
1-(1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)-N-methylmethanamine (PubChem CID 107761377) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 1-(1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)-N-methylmethanamine.
| Compound Name | 1-(1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107761377 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-(1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)-N-methylmethanamine |
| SMILES | CCCCCSc1c(CNC)c(C)nn1C |
| InChI | InChI=1S/C12H23N3S/c1-5-6-7-8-16-12-11(9-13-3)10(2)14-15(12)4/h13H,5-9H2,1-4H3 |
| InChIKey | QRWDSMJNSXUADA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|