C11H21N3S — CID 107751983
(1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)methanamine (PubChem CID 107751983) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is (1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)methanamine.
| Compound Name | (1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 107751983 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (1,3-dimethyl-5-pentylsulfanylpyrazol-4-yl)methanamine |
| SMILES | CCCCCSc1c(CN)c(C)nn1C |
| InChI | InChI=1S/C11H21N3S/c1-4-5-6-7-15-11-10(8-12)9(2)13-14(11)3/h4-8,12H2,1-3H3 |
| InChIKey | AJWYJQMNMNPPJK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|