C15H24ClNS — CID 107762391
1-[4-chloro-2-(3-methylbutan-2-ylsulfanyl)phenyl]butan-2-amine (PubChem CID 107762391) has the molecular formula C15H24ClNS and a molecular weight of 285.88 g/mol. Its IUPAC name is 1-[4-chloro-2-(3-methylbutan-2-ylsulfanyl)phenyl]butan-2-amine.
| Compound Name | 1-[4-chloro-2-(3-methylbutan-2-ylsulfanyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 107762391 |
| Molecular Formula | C15H24ClNS |
| Molecular Weight | 285.88 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-[4-chloro-2-(3-methylbutan-2-ylsulfanyl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Cl)cc1SC(C)C(C)C |
| InChI | InChI=1S/C15H24ClNS/c1-5-14(17)8-12-6-7-13(16)9-15(12)18-11(4)10(2)3/h6-7,9-11,14H,5,8,17H2,1-4H3 |
| InChIKey | KFUFMBIPICHCPA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.88 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |