C15H16BrClN2S — CID 114866429
1-[2-[(3-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]butan-2-amine (PubChem CID 114866429) has the molecular formula C15H16BrClN2S and a molecular weight of 371.73 g/mol. Its IUPAC name is 1-[2-[(3-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]butan-2-amine.
| Compound Name | 1-[2-[(3-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]butan-2-amine |
|---|---|
| PubChem CID | 114866429 |
| Molecular Formula | C15H16BrClN2S |
| Molecular Weight | 371.73 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 1-[2-[(3-bromo-2-pyridinyl)sulfanyl]-4-chlorophenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(Cl)cc1Sc1ncccc1Br |
| InChI | InChI=1S/C15H16BrClN2S/c1-2-12(18)8-10-5-6-11(17)9-14(10)20-15-13(16)4-3-7-19-15/h3-7,9,12H,2,8,18H2,1H3 |
| InChIKey | DLNPOUOJLAUYAJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |