C15H17ClN2S — CID 103694453
1-[2-(2-chlorophenyl)sulfanyl-3-pyridinyl]butan-2-amine (PubChem CID 103694453) has the molecular formula C15H17ClN2S and a molecular weight of 292.84 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)sulfanyl-3-pyridinyl]butan-2-amine.
| Compound Name | 1-[2-(2-chlorophenyl)sulfanyl-3-pyridinyl]butan-2-amine |
|---|---|
| PubChem CID | 103694453 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-[2-(2-chlorophenyl)sulfanyl-3-pyridinyl]butan-2-amine |
| SMILES | CCC(N)Cc1cccnc1Sc1ccccc1Cl |
| InChI | InChI=1S/C15H17ClN2S/c1-2-12(17)10-11-6-5-9-18-15(11)19-14-8-4-3-7-13(14)16/h3-9,12H,2,10,17H2,1H3 |
| InChIKey | NZMAYKVROVSBFP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |