C14H14Cl2N2OS — CID 170892468
2-amino-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-ol (PubChem CID 170892468) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-amino-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-ol.
| Compound Name | 2-amino-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-ol |
|---|---|
| PubChem CID | 170892468 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-amino-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-ol |
| SMILES | NC(CO)Cc1cccnc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2OS/c15-10-3-4-13(12(16)7-10)20-14-9(2-1-5-18-14)6-11(17)8-19/h1-5,7,11,19H,6,8,17H2 |
| InChIKey | XURKGOFIJURLMI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |