C14H14Cl2N2S — CID 170878302
3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine (PubChem CID 170878302) has the molecular formula C14H14Cl2N2S and a molecular weight of 313.25 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine.
| Compound Name | 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 170878302 |
| Molecular Formula | C14H14Cl2N2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine |
| SMILES | NCCCc1cccnc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2S/c15-11-5-6-13(12(16)9-11)19-14-10(3-1-7-17)4-2-8-18-14/h2,4-6,8-9H,1,3,7,17H2 |
| InChIKey | LYWZTWXGZULIAC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |