About 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine
3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine (PubChem CID 170878302) has the molecular formula C14H14Cl2N2S
and a molecular weight of 313.25 g/mol. Its IUPAC name is 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine |
| PubChem CID | 170878302 |
| Molecular Formula | C14H14Cl2N2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine |
| SMILES | NCCCc1cccnc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2S/c15-11-5-6-13(12(16)9-11)19-14-10(3-1-7-17)4-2-8-18-14/h2,4-6,8-9H,1,3,7,17H2 |
| InChIKey | LYWZTWXGZULIAC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine?
The IUPAC name of 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine (CID 170878302) is 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine.
What is the SMILES notation for 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine?
The canonical SMILES for 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine is NCCCc1cccnc1Sc1ccc(Cl)cc1Cl.
What is the InChIKey of 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine?
The InChIKey is LYWZTWXGZULIAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2S/c15-11-5-6-13(12(16)9-11)19-14-10(3-1-7-17)4-2-8-18-14/h2,4-6,8-9H,1,3,7,17H2.
What are the key properties of 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine?
3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine has a molecular weight of 313.25 g/mol, XLogP of 4.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]propan-1-amine is sourced from PubChem (CID 170878302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).