About (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide
(E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide (PubChem CID 170876723) has the molecular formula C14H10Cl2N2OS
and a molecular weight of 325.22 g/mol. Its IUPAC name is (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide.
Molecular Properties
| Compound Name | (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide |
| PubChem CID | 170876723 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cccnc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-10-4-5-12(11(16)8-10)20-14-9(2-1-7-18-14)3-6-13(17)19/h1-8H,(H2,17,19)/b6-3+ |
| InChIKey | FKMCNIUZEUFLIH-ZZXKWVIFSA-N |
| XLogP | 4.04 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide?
The IUPAC name of (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide (CID 170876723) is (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide.
What is the SMILES notation for (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide?
The canonical SMILES for (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide is NC(=O)/C=C/c1cccnc1Sc1ccc(Cl)cc1Cl.
What is the InChIKey of (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide?
The InChIKey is FKMCNIUZEUFLIH-ZZXKWVIFSA-N. The full InChI is InChI=1S/C14H10Cl2N2OS/c15-10-4-5-12(11(16)8-10)20-14-9(2-1-7-18-14)3-6-13(17)19/h1-8H,(H2,17,19)/b6-3+.
What are the key properties of (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide?
(E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide has a molecular weight of 325.22 g/mol, XLogP of 4.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide is sourced from PubChem (CID 170876723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).