C14H10Cl2N2OS — CID 170876723
(E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide (PubChem CID 170876723) has the molecular formula C14H10Cl2N2OS and a molecular weight of 325.22 g/mol. Its IUPAC name is (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 170876723 |
| Molecular Formula | C14H10Cl2N2OS |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (E)-3-[2-(2,4-dichlorophenyl)sulfanyl-3-pyridinyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cccnc1Sc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N2OS/c15-10-4-5-12(11(16)8-10)20-14-9(2-1-7-18-14)3-6-13(17)19/h1-8H,(H2,17,19)/b6-3+ |
| InChIKey | FKMCNIUZEUFLIH-ZZXKWVIFSA-N |
| XLogP | 4.04 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|