About 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde
2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde (PubChem CID 129079194) has the molecular formula C13H10Cl2N2OS
and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde |
| PubChem CID | 129079194 |
| Molecular Formula | C13H10Cl2N2OS |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde |
| SMILES | NCc1c(Sc2ncccc2C=O)ccc(Cl)c1Cl |
| InChI | InChI=1S/C13H10Cl2N2OS/c14-10-3-4-11(9(6-16)12(10)15)19-13-8(7-18)2-1-5-17-13/h1-5,7H,6,16H2 |
| InChIKey | KRNZGWMORJWCAE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde?
The IUPAC name of 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde (CID 129079194) is 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde.
What is the SMILES notation for 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde?
The canonical SMILES for 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde is NCc1c(Sc2ncccc2C=O)ccc(Cl)c1Cl.
What is the InChIKey of 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde?
The InChIKey is KRNZGWMORJWCAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2N2OS/c14-10-3-4-11(9(6-16)12(10)15)19-13-8(7-18)2-1-5-17-13/h1-5,7H,6,16H2.
What are the key properties of 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde?
2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde has a molecular weight of 313.21 g/mol, XLogP of 3.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(aminomethyl)-3,4-dichlorophenyl]sulfanylpyridine-3-carbaldehyde is sourced from PubChem (CID 129079194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).