C15H13NOS — CID 114057208
2-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyridine-3-carbaldehyde (PubChem CID 114057208) has the molecular formula C15H13NOS and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyridine-3-carbaldehyde.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 114057208 |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)pyridine-3-carbaldehyde |
| SMILES | O=Cc1cccnc1Sc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H13NOS/c17-10-13-5-2-8-16-15(13)18-14-7-6-11-3-1-4-12(11)9-14/h2,5-10H,1,3-4H2 |
| InChIKey | XXKXRPNSJIIRLE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|