C13H10ClNOS2 — CID 80692328
4-chloro-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 80692328) has the molecular formula C13H10ClNOS2 and a molecular weight of 295.82 g/mol. Its IUPAC name is 4-chloro-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80692328 |
| Molecular Formula | C13H10ClNOS2 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | 4-chloro-2-(2,3-dihydro-1H-inden-5-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(Sc2ccc3c(c2)CCC3)nc1Cl |
| InChI | InChI=1S/C13H10ClNOS2/c14-12-11(7-16)18-13(15-12)17-10-5-4-8-2-1-3-9(8)6-10/h4-7H,1-3H2 |
| InChIKey | XOPKKMLBDCCDSG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|