C11H11ClN4OS2 — CID 113221109
4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 113221109) has the molecular formula C11H11ClN4OS2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 113221109 |
| Molecular Formula | C11H11ClN4OS2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 4-chloro-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1sc(Sc2nnc3n2CCCCC3)nc1Cl |
| InChI | InChI=1S/C11H11ClN4OS2/c12-9-7(6-17)18-11(13-9)19-10-15-14-8-4-2-1-3-5-16(8)10/h6H,1-5H2 |
| InChIKey | BUOGBXIMQXSAIZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|