C13H13BrCl2N2OS — CID 129079381
[2-[2-(aminomethyl)-3-bromo-6-chlorophenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride (PubChem CID 129079381) has the molecular formula C13H13BrCl2N2OS and a molecular weight of 396.14 g/mol. Its IUPAC name is [2-[2-(aminomethyl)-3-bromo-6-chlorophenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride.
| Compound Name | [2-[2-(aminomethyl)-3-bromo-6-chlorophenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 129079381 |
| Molecular Formula | C13H13BrCl2N2OS |
| Molecular Weight | 396.14 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | [2-[2-(aminomethyl)-3-bromo-6-chlorophenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride |
| SMILES | Cl.NCc1c(Br)ccc(Cl)c1Sc1ncccc1CO |
| InChI | InChI=1S/C13H12BrClN2OS.ClH/c14-10-3-4-11(15)12(9(10)6-16)19-13-8(7-18)2-1-5-17-13;/h1-5,18H,6-7,16H2;1H |
| InChIKey | MXZSZSJRJHJOBK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.14 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |