C18H16ClN3OS — CID 129078938
[2-[2-(aminomethyl)-6-chloro-3-pyridin-4-ylphenyl]sulfanyl-3-pyridinyl]methanol (PubChem CID 129078938) has the molecular formula C18H16ClN3OS and a molecular weight of 357.87 g/mol. Its IUPAC name is [2-[2-(aminomethyl)-6-chloro-3-pyridin-4-ylphenyl]sulfanyl-3-pyridinyl]methanol.
| Compound Name | [2-[2-(aminomethyl)-6-chloro-3-pyridin-4-ylphenyl]sulfanyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 129078938 |
| Molecular Formula | C18H16ClN3OS |
| Molecular Weight | 357.87 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [2-[2-(aminomethyl)-6-chloro-3-pyridin-4-ylphenyl]sulfanyl-3-pyridinyl]methanol |
| SMILES | NCc1c(-c2ccncc2)ccc(Cl)c1Sc1ncccc1CO |
| InChI | InChI=1S/C18H16ClN3OS/c19-16-4-3-14(12-5-8-21-9-6-12)15(10-20)17(16)24-18-13(11-23)2-1-7-22-18/h1-9,23H,10-11,20H2 |
| InChIKey | LXDOWSQDYBQUAW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.87 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |