C23H21ClN2O2S — CID 129078853
[2-[2-(aminomethyl)-6-chloro-4-(3-phenylmethoxyprop-1-ynyl)phenyl]sulfanyl-3-pyridinyl]methanol (PubChem CID 129078853) has the molecular formula C23H21ClN2O2S and a molecular weight of 424.95 g/mol. Its IUPAC name is [2-[2-(aminomethyl)-6-chloro-4-(3-phenylmethoxyprop-1-ynyl)phenyl]sulfanyl-3-pyridinyl]methanol.
| Compound Name | [2-[2-(aminomethyl)-6-chloro-4-(3-phenylmethoxyprop-1-ynyl)phenyl]sulfanyl-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 129078853 |
| Molecular Formula | C23H21ClN2O2S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [2-[2-(aminomethyl)-6-chloro-4-(3-phenylmethoxyprop-1-ynyl)phenyl]sulfanyl-3-pyridinyl]methanol |
| SMILES | NCc1cc(C#CCOCc2ccccc2)cc(Cl)c1Sc1ncccc1CO |
| InChI | InChI=1S/C23H21ClN2O2S/c24-21-13-18(8-5-11-28-16-17-6-2-1-3-7-17)12-20(14-25)22(21)29-23-19(15-27)9-4-10-26-23/h1-4,6-7,9-10,12-13,27H,11,14-16,25H2 |
| InChIKey | FSVABQMICSQCPC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|