C18H16Cl2FN3OS — CID 129079156
[2-[2-(aminomethyl)-6-chloro-4-(2-fluoro-4-pyridinyl)phenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride (PubChem CID 129079156) has the molecular formula C18H16Cl2FN3OS and a molecular weight of 412.32 g/mol. Its IUPAC name is [2-[2-(aminomethyl)-6-chloro-4-(2-fluoro-4-pyridinyl)phenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride.
| Compound Name | [2-[2-(aminomethyl)-6-chloro-4-(2-fluoro-4-pyridinyl)phenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 129079156 |
| Molecular Formula | C18H16Cl2FN3OS |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | [2-[2-(aminomethyl)-6-chloro-4-(2-fluoro-4-pyridinyl)phenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride |
| SMILES | Cl.NCc1cc(-c2ccnc(F)c2)cc(Cl)c1Sc1ncccc1CO |
| InChI | InChI=1S/C18H15ClFN3OS.ClH/c19-15-7-13(11-3-5-22-16(20)8-11)6-14(9-21)17(15)25-18-12(10-24)2-1-4-23-18;/h1-8,24H,9-10,21H2;1H |
| InChIKey | JRVYAPOLRZYIBM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|