C19H18Cl2N2OS — CID 129079624
[2-[2-(aminomethyl)-6-chloro-3-phenylphenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride (PubChem CID 129079624) has the molecular formula C19H18Cl2N2OS and a molecular weight of 393.34 g/mol. Its IUPAC name is [2-[2-(aminomethyl)-6-chloro-3-phenylphenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride.
| Compound Name | [2-[2-(aminomethyl)-6-chloro-3-phenylphenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 129079624 |
| Molecular Formula | C19H18Cl2N2OS |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | [2-[2-(aminomethyl)-6-chloro-3-phenylphenyl]sulfanyl-3-pyridinyl]methanol;hydrochloride |
| SMILES | Cl.NCc1c(-c2ccccc2)ccc(Cl)c1Sc1ncccc1CO |
| InChI | InChI=1S/C19H17ClN2OS.ClH/c20-17-9-8-15(13-5-2-1-3-6-13)16(11-21)18(17)24-19-14(12-23)7-4-10-22-19;/h1-10,23H,11-12,21H2;1H |
| InChIKey | NOBRHZQZXLKCDX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |